C19H14NO7S- — CID 2175132
4-[5-[(E)-[3-(2-methoxy-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-3-methylbenzoate (PubChem CID 2175132) has the molecular formula C19H14NO7S- and a molecular weight of 400.39 g/mol. Its IUPAC name is 4-[5-[(E)-[3-(2-methoxy-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-3-methylbenzoate.
| Compound Name | 4-[5-[(E)-[3-(2-methoxy-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-3-methylbenzoate |
|---|---|
| PubChem CID | 2175132 |
| Molecular Formula | C19H14NO7S- |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 4-[5-[(E)-[3-(2-methoxy-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-3-methylbenzoate |
| SMILES | COC(=O)CN1C(=O)S/C(=C/c2ccc(-c3ccc(C(=O)[O-])cc3C)o2)C1=O |
| InChI | InChI=1S/C19H15NO7S/c1-10-7-11(18(23)24)3-5-13(10)14-6-4-12(27-14)8-15-17(22)20(19(25)28-15)9-16(21)26-2/h3-8H,9H2,1-2H3,(H,23,24)/p-1/b15-8+ |
| InChIKey | NZGAHVKYNJJCCT-OVCLIPMQSA-M |
| XLogP | 1.83 |
| TPSA | 116.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|