C19H14N2O6S-2 — CID 8606472
3-[5-[(Z)-2-carboxylato-2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethenyl]furan-2-yl]-2-methylbenzoate (PubChem CID 8606472) has the molecular formula C19H14N2O6S-2 and a molecular weight of 398.40 g/mol. Its IUPAC name is 3-[5-[(Z)-2-carboxylato-2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethenyl]furan-2-yl]-2-methylbenzoate.
| Compound Name | 3-[5-[(Z)-2-carboxylato-2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethenyl]furan-2-yl]-2-methylbenzoate |
|---|---|
| PubChem CID | 8606472 |
| Molecular Formula | C19H14N2O6S-2 |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 3-[5-[(Z)-2-carboxylato-2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethenyl]furan-2-yl]-2-methylbenzoate |
| SMILES | CCc1nnc(S/C(=C\c2ccc(-c3cccc(C(=O)[O-])c3C)o2)C(=O)[O-])o1 |
| InChI | InChI=1S/C19H16N2O6S/c1-3-16-20-21-19(27-16)28-15(18(24)25)9-11-7-8-14(26-11)12-5-4-6-13(10(12)2)17(22)23/h4-9H,3H2,1-2H3,(H,22,23)(H,24,25)/p-2/b15-9- |
| InChIKey | AZLHWHDJJNNMED-DHDCSXOGSA-L |
| XLogP | 1.45 |
| TPSA | 132.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|