C13H11BrN3O4S- — CID 54725599
2-bromo-4-[(E)-2-carboxy-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethenyl]-6-methoxyphenolate (PubChem CID 54725599) has the molecular formula C13H11BrN3O4S- and a molecular weight of 385.22 g/mol. Its IUPAC name is 2-bromo-4-[(E)-2-carboxy-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethenyl]-6-methoxyphenolate.
| Compound Name | 2-bromo-4-[(E)-2-carboxy-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethenyl]-6-methoxyphenolate |
|---|---|
| PubChem CID | 54725599 |
| Molecular Formula | C13H11BrN3O4S- |
| Molecular Weight | 385.22 g/mol |
| Exact Mass | 383.97 |
| IUPAC Name | 2-bromo-4-[(E)-2-carboxy-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethenyl]-6-methoxyphenolate |
| SMILES | COc1cc(/C=C(/Sc2n[nH]c(C)n2)C(=O)O)cc(Br)c1[O-] |
| InChI | InChI=1S/C13H12BrN3O4S/c1-6-15-13(17-16-6)22-10(12(19)20)5-7-3-8(14)11(18)9(4-7)21-2/h3-5,18H,1-2H3,(H,19,20)(H,15,16,17)/p-1/b10-5+ |
| InChIKey | ULBWTQCWZBBKSQ-BJMVGYQFSA-M |
| XLogP | 2.18 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.22 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|