C22H20N4O4S — CID 126195077
(Z)-3-[4-[(2-cyanophenyl)methoxy]-3-ethoxyphenyl]-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid (PubChem CID 126195077) has the molecular formula C22H20N4O4S and a molecular weight of 436.49 g/mol. Its IUPAC name is (Z)-3-[4-[(2-cyanophenyl)methoxy]-3-ethoxyphenyl]-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid.
| Compound Name | (Z)-3-[4-[(2-cyanophenyl)methoxy]-3-ethoxyphenyl]-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 126195077 |
| Molecular Formula | C22H20N4O4S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | (Z)-3-[4-[(2-cyanophenyl)methoxy]-3-ethoxyphenyl]-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid |
| SMILES | CCOc1cc(/C=C(\Sc2n[nH]c(C)n2)C(=O)O)ccc1OCc1ccccc1C#N |
| InChI | InChI=1S/C22H20N4O4S/c1-3-29-19-10-15(11-20(21(27)28)31-22-24-14(2)25-26-22)8-9-18(19)30-13-17-7-5-4-6-16(17)12-23/h4-11H,3,13H2,1-2H3,(H,27,28)(H,24,25,26)/b20-11- |
| InChIKey | GSUZCBCFMXHJGT-JAIQZWGSSA-N |
| XLogP | 4.18 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|