C24H22N4O3 — CID 1348038
1-[[4-[(2-cyanophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-3-phenylurea (PubChem CID 1348038) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is 1-[[4-[(2-cyanophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-3-phenylurea.
| Compound Name | 1-[[4-[(2-cyanophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-3-phenylurea |
|---|---|
| PubChem CID | 1348038 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 1-[[4-[(2-cyanophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-3-phenylurea |
| SMILES | CCOc1cc(C=NNC(=O)Nc2ccccc2)ccc1OCc1ccccc1C#N |
| InChI | InChI=1S/C24H22N4O3/c1-2-30-23-14-18(16-26-28-24(29)27-21-10-4-3-5-11-21)12-13-22(23)31-17-20-9-7-6-8-19(20)15-25/h3-14,16H,2,17H2,1H3,(H2,27,28,29) |
| InChIKey | GDDGEYSBCNNYLJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|