C19H14ClFO3 — CID 7515050
(E)-3-(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)-1-(4-fluorophenyl)prop-2-en-1-one (PubChem CID 7515050) has the molecular formula C19H14ClFO3 and a molecular weight of 344.77 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)-1-(4-fluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)-1-(4-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 7515050 |
| Molecular Formula | C19H14ClFO3 |
| Molecular Weight | 344.77 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | (E)-3-(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)-1-(4-fluorophenyl)prop-2-en-1-one |
| SMILES | C#CCOc1c(Cl)cc(/C=C/C(=O)c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C19H14ClFO3/c1-3-10-24-19-16(20)11-13(12-18(19)23-2)4-9-17(22)14-5-7-15(21)8-6-14/h1,4-9,11-12H,10H2,2H3/b9-4+ |
| InChIKey | AGOBTAUGLFCNCZ-RUDMXATFSA-N |
| XLogP | 4.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.77 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|