C16H12N2O4S — CID 9067429
S-[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl] 2-hydroxybenzenecarbothioate (PubChem CID 9067429) has the molecular formula C16H12N2O4S and a molecular weight of 328.35 g/mol. Its IUPAC name is S-[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl] 2-hydroxybenzenecarbothioate.
| Compound Name | S-[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl] 2-hydroxybenzenecarbothioate |
|---|---|
| PubChem CID | 9067429 |
| Molecular Formula | C16H12N2O4S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | S-[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl] 2-hydroxybenzenecarbothioate |
| SMILES | COc1cccc(-c2nnc(SC(=O)c3ccccc3O)o2)c1 |
| InChI | InChI=1S/C16H12N2O4S/c1-21-11-6-4-5-10(9-11)14-17-18-16(22-14)23-15(20)12-7-2-3-8-13(12)19/h2-9,19H,1H3 |
| InChIKey | QQDXTLSEQRWIKT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|