C18H17N3O3 — CID 4064257
N-[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-2,5-dimethylbenzamide (PubChem CID 4064257) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is N-[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-2,5-dimethylbenzamide.
| Compound Name | N-[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 4064257 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | N-[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-2,5-dimethylbenzamide |
| SMILES | COc1cccc(-c2nnc(NC(=O)c3cc(C)ccc3C)o2)c1 |
| InChI | InChI=1S/C18H17N3O3/c1-11-7-8-12(2)15(9-11)16(22)19-18-21-20-17(24-18)13-5-4-6-14(10-13)23-3/h4-10H,1-3H3,(H,19,21,22) |
| InChIKey | UVGBRYFQNALHRZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |