C17H15N3O5S — CID 43981074
N-[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-2-methylsulfonylbenzamide (PubChem CID 43981074) has the molecular formula C17H15N3O5S and a molecular weight of 373.39 g/mol. Its IUPAC name is N-[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-2-methylsulfonylbenzamide.
| Compound Name | N-[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-2-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 43981074 |
| Molecular Formula | C17H15N3O5S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | N-[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-2-methylsulfonylbenzamide |
| SMILES | COc1cccc(-c2nnc(NC(=O)c3ccccc3S(C)(=O)=O)o2)c1 |
| InChI | InChI=1S/C17H15N3O5S/c1-24-12-7-5-6-11(10-12)16-19-20-17(25-16)18-15(21)13-8-3-4-9-14(13)26(2,22)23/h3-10H,1-2H3,(H,18,20,21) |
| InChIKey | JOJBHBMGZYECCS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |