C16H13BrN2O4S — CID 8705704
(E)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-[4-bromo-5-(dimethylamino)furan-2-yl]prop-2-enoic acid (PubChem CID 8705704) has the molecular formula C16H13BrN2O4S and a molecular weight of 409.26 g/mol. Its IUPAC name is (E)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-[4-bromo-5-(dimethylamino)furan-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-[4-bromo-5-(dimethylamino)furan-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 8705704 |
| Molecular Formula | C16H13BrN2O4S |
| Molecular Weight | 409.26 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | (E)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-[4-bromo-5-(dimethylamino)furan-2-yl]prop-2-enoic acid |
| SMILES | CN(C)c1oc(/C=C(/Sc2nc3ccccc3o2)C(=O)O)cc1Br |
| InChI | InChI=1S/C16H13BrN2O4S/c1-19(2)14-10(17)7-9(22-14)8-13(15(20)21)24-16-18-11-5-3-4-6-12(11)23-16/h3-8H,1-2H3,(H,20,21)/b13-8+ |
| InChIKey | MDZPNPVKLNHPME-MDWZMJQESA-N |
| XLogP | 4.47 |
| TPSA | 79.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.26 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|