C17H12NO4S- — CID 8705642
(E)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-(3-methoxyphenyl)prop-2-enoate (PubChem CID 8705642) has the molecular formula C17H12NO4S- and a molecular weight of 326.35 g/mol. Its IUPAC name is (E)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-(3-methoxyphenyl)prop-2-enoate.
| Compound Name | (E)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-(3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8705642 |
| Molecular Formula | C17H12NO4S- |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | (E)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-(3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cccc(/C=C(/Sc2nc3ccccc3o2)C(=O)[O-])c1 |
| InChI | InChI=1S/C17H13NO4S/c1-21-12-6-4-5-11(9-12)10-15(16(19)20)23-17-18-13-7-2-3-8-14(13)22-17/h2-10H,1H3,(H,19,20)/p-1/b15-10+ |
| InChIKey | ZSEBUSKGJUEDIC-XNTDXEJSSA-M |
| XLogP | 2.72 |
| TPSA | 75.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|