C16H13NO2 — CID 18083407
2-[(E)-2-(3-methoxyphenyl)ethenyl]-1,3-benzoxazole (PubChem CID 18083407) has the molecular formula C16H13NO2 and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-[(E)-2-(3-methoxyphenyl)ethenyl]-1,3-benzoxazole.
| Compound Name | 2-[(E)-2-(3-methoxyphenyl)ethenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 18083407 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 2-[(E)-2-(3-methoxyphenyl)ethenyl]-1,3-benzoxazole |
| SMILES | COc1cccc(/C=C/c2nc3ccccc3o2)c1 |
| InChI | InChI=1S/C16H13NO2/c1-18-13-6-4-5-12(11-13)9-10-16-17-14-7-2-3-8-15(14)19-16/h2-11H,1H3/b10-9+ |
| InChIKey | XSKCIWQNRUZALQ-MDZDMXLPSA-N |
| XLogP | 4.01 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |