C40H24N6O4 — CID 57286159
2-[2-[3,5,6-tris[2-(1,3-benzoxazol-2-yl)ethenyl]pyrazin-2-yl]ethenyl]-1,3-benzoxazole (PubChem CID 57286159) has the molecular formula C40H24N6O4 and a molecular weight of 652.67 g/mol. Its IUPAC name is 2-[2-[3,5,6-tris[2-(1,3-benzoxazol-2-yl)ethenyl]pyrazin-2-yl]ethenyl]-1,3-benzoxazole.
| Compound Name | 2-[2-[3,5,6-tris[2-(1,3-benzoxazol-2-yl)ethenyl]pyrazin-2-yl]ethenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 57286159 |
| Molecular Formula | C40H24N6O4 |
| Molecular Weight | 652.67 g/mol |
| Exact Mass | 652.19 |
| IUPAC Name | 2-[2-[3,5,6-tris[2-(1,3-benzoxazol-2-yl)ethenyl]pyrazin-2-yl]ethenyl]-1,3-benzoxazole |
| SMILES | C(=Cc1nc(C=Cc2nc3ccccc3o2)c(C=Cc2nc3ccccc3o2)nc1C=Cc1nc2ccccc2o1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C40H24N6O4/c1-5-13-33-29(9-1)43-37(47-33)21-17-25-26(18-22-38-44-30-10-2-6-14-34(30)48-38)42-28(20-24-40-46-32-12-4-8-16-36(32)50-40)27(41-25)19-23-39-45-31-11-3-7-15-35(31)49-39/h1-24H |
| InChIKey | DBNVWRDDZDEUIQ-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 129.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.67 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |