C15H9Cl2NO — CID 3767247
2-[2-(2,4-dichlorophenyl)ethenyl]-1,3-benzoxazole (PubChem CID 3767247) has the molecular formula C15H9Cl2NO and a molecular weight of 290.15 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenyl)ethenyl]-1,3-benzoxazole.
| Compound Name | 2-[2-(2,4-dichlorophenyl)ethenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 3767247 |
| Molecular Formula | C15H9Cl2NO |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 2-[2-(2,4-dichlorophenyl)ethenyl]-1,3-benzoxazole |
| SMILES | Clc1ccc(C=Cc2nc3ccccc3o2)c(Cl)c1 |
| InChI | InChI=1S/C15H9Cl2NO/c16-11-7-5-10(12(17)9-11)6-8-15-18-13-3-1-2-4-14(13)19-15/h1-9H |
| InChIKey | CGSZVEMSWPKGIS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |