C14H10Cl2 — CID 66779322
2,4-dichloro-1-(2-phenylethenyl)benzene (PubChem CID 66779322) has the molecular formula C14H10Cl2 and a molecular weight of 249.14 g/mol. Its IUPAC name is 2,4-dichloro-1-(2-phenylethenyl)benzene.
| Compound Name | 2,4-dichloro-1-(2-phenylethenyl)benzene |
|---|---|
| PubChem CID | 66779322 |
| Molecular Formula | C14H10Cl2 |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 2,4-dichloro-1-(2-phenylethenyl)benzene |
| SMILES | Clc1ccc(C=Cc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C14H10Cl2/c15-13-9-8-12(14(16)10-13)7-6-11-4-2-1-3-5-11/h1-10H |
| InChIKey | JUXNFVMNPVWORX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|