C17H11Cl2N — CID 146000729
4,6-dichloro-2-[(E)-2-phenylethenyl]quinoline (PubChem CID 146000729) has the molecular formula C17H11Cl2N and a molecular weight of 300.19 g/mol. Its IUPAC name is 4,6-dichloro-2-[(E)-2-phenylethenyl]quinoline.
| Compound Name | 4,6-dichloro-2-[(E)-2-phenylethenyl]quinoline |
|---|---|
| PubChem CID | 146000729 |
| Molecular Formula | C17H11Cl2N |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 4,6-dichloro-2-[(E)-2-phenylethenyl]quinoline |
| SMILES | Clc1ccc2nc(/C=C/c3ccccc3)cc(Cl)c2c1 |
| InChI | InChI=1S/C17H11Cl2N/c18-13-7-9-17-15(10-13)16(19)11-14(20-17)8-6-12-4-2-1-3-5-12/h1-11H/b8-6+ |
| InChIKey | GOBYTUYMYMEVMB-SOFGYWHQSA-N |
| XLogP | 5.71 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |