C18H12BrCl2NO — CID 146001018
2-[(E)-2-(4-bromo-2-methoxyphenyl)ethenyl]-4,6-dichloroquinoline (PubChem CID 146001018) has the molecular formula C18H12BrCl2NO and a molecular weight of 409.11 g/mol. Its IUPAC name is 2-[(E)-2-(4-bromo-2-methoxyphenyl)ethenyl]-4,6-dichloroquinoline.
| Compound Name | 2-[(E)-2-(4-bromo-2-methoxyphenyl)ethenyl]-4,6-dichloroquinoline |
|---|---|
| PubChem CID | 146001018 |
| Molecular Formula | C18H12BrCl2NO |
| Molecular Weight | 409.11 g/mol |
| Exact Mass | 406.95 |
| IUPAC Name | 2-[(E)-2-(4-bromo-2-methoxyphenyl)ethenyl]-4,6-dichloroquinoline |
| SMILES | COc1cc(Br)ccc1/C=C/c1cc(Cl)c2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C18H12BrCl2NO/c1-23-18-8-12(19)4-2-11(18)3-6-14-10-16(21)15-9-13(20)5-7-17(15)22-14/h2-10H,1H3/b6-3+ |
| InChIKey | SBJXKWUTHZCZEE-ZZXKWVIFSA-N |
| XLogP | 6.48 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.11 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |