C14H9BrCl2O2 — CID 115368770
(4-bromo-2-methoxyphenyl)-(2,5-dichlorophenyl)methanone (PubChem CID 115368770) has the molecular formula C14H9BrCl2O2 and a molecular weight of 360.03 g/mol. Its IUPAC name is (4-bromo-2-methoxyphenyl)-(2,5-dichlorophenyl)methanone.
| Compound Name | (4-bromo-2-methoxyphenyl)-(2,5-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 115368770 |
| Molecular Formula | C14H9BrCl2O2 |
| Molecular Weight | 360.03 g/mol |
| Exact Mass | 357.92 |
| IUPAC Name | (4-bromo-2-methoxyphenyl)-(2,5-dichlorophenyl)methanone |
| SMILES | COc1cc(Br)ccc1C(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H9BrCl2O2/c1-19-13-6-8(15)2-4-10(13)14(18)11-7-9(16)3-5-12(11)17/h2-7H,1H3 |
| InChIKey | LZJZVHDDEUZNNV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.03 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |