C26H31ClN4 — CID 162665698
6-chloro-N-[4-(4-methylpiperazin-1-yl)butyl]-2-[(E)-2-phenylethenyl]quinolin-4-amine (PubChem CID 162665698) has the molecular formula C26H31ClN4 and a molecular weight of 435.02 g/mol. Its IUPAC name is 6-chloro-N-[4-(4-methylpiperazin-1-yl)butyl]-2-[(E)-2-phenylethenyl]quinolin-4-amine.
| Compound Name | 6-chloro-N-[4-(4-methylpiperazin-1-yl)butyl]-2-[(E)-2-phenylethenyl]quinolin-4-amine |
|---|---|
| PubChem CID | 162665698 |
| Molecular Formula | C26H31ClN4 |
| Molecular Weight | 435.02 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 6-chloro-N-[4-(4-methylpiperazin-1-yl)butyl]-2-[(E)-2-phenylethenyl]quinolin-4-amine |
| SMILES | CN1CCN(CCCCNc2cc(/C=C/c3ccccc3)nc3ccc(Cl)cc23)CC1 |
| InChI | InChI=1S/C26H31ClN4/c1-30-15-17-31(18-16-30)14-6-5-13-28-26-20-23(11-9-21-7-3-2-4-8-21)29-25-12-10-22(27)19-24(25)26/h2-4,7-12,19-20H,5-6,13-18H2,1H3,(H,28,29)/b11-9+ |
| InChIKey | PPAWNVJPBVIPRQ-PKNBQFBNSA-N |
| XLogP | 5.50 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.02 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|