C23H27Cl2N3O — CID 146242192
4-[(E)-2-(2,4-dichlorophenyl)ethenyl]-N-[3-(4-methylpiperazin-1-yl)propyl]benzamide (PubChem CID 146242192) has the molecular formula C23H27Cl2N3O and a molecular weight of 432.40 g/mol. Its IUPAC name is 4-[(E)-2-(2,4-dichlorophenyl)ethenyl]-N-[3-(4-methylpiperazin-1-yl)propyl]benzamide.
| Compound Name | 4-[(E)-2-(2,4-dichlorophenyl)ethenyl]-N-[3-(4-methylpiperazin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 146242192 |
| Molecular Formula | C23H27Cl2N3O |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 4-[(E)-2-(2,4-dichlorophenyl)ethenyl]-N-[3-(4-methylpiperazin-1-yl)propyl]benzamide |
| SMILES | CN1CCN(CCCNC(=O)c2ccc(/C=C/c3ccc(Cl)cc3Cl)cc2)CC1 |
| InChI | InChI=1S/C23H27Cl2N3O/c1-27-13-15-28(16-14-27)12-2-11-26-23(29)20-7-4-18(5-8-20)3-6-19-9-10-21(24)17-22(19)25/h3-10,17H,2,11-16H2,1H3,(H,26,29)/b6-3+ |
| InChIKey | UWYZYGFVEGGBIO-ZZXKWVIFSA-N |
| XLogP | 4.53 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|