C25H27ClFN3O — CID 162645505
6-chloro-2-[(E)-2-(4-fluorophenyl)ethenyl]-N-(4-morpholin-4-ylbutyl)quinolin-4-amine (PubChem CID 162645505) has the molecular formula C25H27ClFN3O and a molecular weight of 439.96 g/mol. Its IUPAC name is 6-chloro-2-[(E)-2-(4-fluorophenyl)ethenyl]-N-(4-morpholin-4-ylbutyl)quinolin-4-amine.
| Compound Name | 6-chloro-2-[(E)-2-(4-fluorophenyl)ethenyl]-N-(4-morpholin-4-ylbutyl)quinolin-4-amine |
|---|---|
| PubChem CID | 162645505 |
| Molecular Formula | C25H27ClFN3O |
| Molecular Weight | 439.96 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 6-chloro-2-[(E)-2-(4-fluorophenyl)ethenyl]-N-(4-morpholin-4-ylbutyl)quinolin-4-amine |
| SMILES | Fc1ccc(/C=C/c2cc(NCCCCN3CCOCC3)c3cc(Cl)ccc3n2)cc1 |
| InChI | InChI=1S/C25H27ClFN3O/c26-20-6-10-24-23(17-20)25(28-11-1-2-12-30-13-15-31-16-14-30)18-22(29-24)9-5-19-3-7-21(27)8-4-19/h3-10,17-18H,1-2,11-16H2,(H,28,29)/b9-5+ |
| InChIKey | MNOKNBDUYLMXKC-WEVVVXLNSA-N |
| XLogP | 5.72 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.96 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|