C28H38ClN7O — CID 56970358
N-[5-chloro-2-[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]phenyl]-4-(4-methylpiperazin-1-yl)butanamide (PubChem CID 56970358) has the molecular formula C28H38ClN7O and a molecular weight of 524.11 g/mol. Its IUPAC name is N-[5-chloro-2-[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]phenyl]-4-(4-methylpiperazin-1-yl)butanamide.
| Compound Name | N-[5-chloro-2-[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]phenyl]-4-(4-methylpiperazin-1-yl)butanamide |
|---|---|
| PubChem CID | 56970358 |
| Molecular Formula | C28H38ClN7O |
| Molecular Weight | 524.11 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | N-[5-chloro-2-[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]phenyl]-4-(4-methylpiperazin-1-yl)butanamide |
| SMILES | CN(C)CCCNc1nc(-c2ccc(Cl)cc2NC(=O)CCCN2CCN(C)CC2)nc2ccccc12 |
| InChI | InChI=1S/C28H38ClN7O/c1-34(2)14-7-13-30-27-22-8-4-5-9-24(22)32-28(33-27)23-12-11-21(29)20-25(23)31-26(37)10-6-15-36-18-16-35(3)17-19-36/h4-5,8-9,11-12,20H,6-7,10,13-19H2,1-3H3,(H,31,37)(H,30,32,33) |
| InChIKey | KVIAKNCTDSRGFW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.11 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|