C20H15Cl2OP — CID 162401523
2,4-dichloro-1-[(E)-2-diphenylphosphorylethenyl]benzene (PubChem CID 162401523) has the molecular formula C20H15Cl2OP and a molecular weight of 373.22 g/mol. Its IUPAC name is 2,4-dichloro-1-[(E)-2-diphenylphosphorylethenyl]benzene.
| Compound Name | 2,4-dichloro-1-[(E)-2-diphenylphosphorylethenyl]benzene |
|---|---|
| PubChem CID | 162401523 |
| Molecular Formula | C20H15Cl2OP |
| Molecular Weight | 373.22 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | 2,4-dichloro-1-[(E)-2-diphenylphosphorylethenyl]benzene |
| SMILES | O=P(/C=C/c1ccc(Cl)cc1Cl)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H15Cl2OP/c21-17-12-11-16(20(22)15-17)13-14-24(23,18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-15H/b14-13+ |
| InChIKey | WJCJFTBTQOROCI-BUHFOSPRSA-N |
| XLogP | 5.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.22 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|