C16H10Cl4O — CID 139944429
2,4-dichloro-1-[2-[2-(2,4-dichlorophenyl)ethenoxy]ethenyl]benzene (PubChem CID 139944429) has the molecular formula C16H10Cl4O and a molecular weight of 360.07 g/mol. Its IUPAC name is 2,4-dichloro-1-[2-[2-(2,4-dichlorophenyl)ethenoxy]ethenyl]benzene.
| Compound Name | 2,4-dichloro-1-[2-[2-(2,4-dichlorophenyl)ethenoxy]ethenyl]benzene |
|---|---|
| PubChem CID | 139944429 |
| Molecular Formula | C16H10Cl4O |
| Molecular Weight | 360.07 g/mol |
| Exact Mass | 357.95 |
| IUPAC Name | 2,4-dichloro-1-[2-[2-(2,4-dichlorophenyl)ethenoxy]ethenyl]benzene |
| SMILES | Clc1ccc(C=COC=Cc2ccc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H10Cl4O/c17-13-3-1-11(15(19)9-13)5-7-21-8-6-12-2-4-14(18)10-16(12)20/h1-10H |
| InChIKey | DTLFLJOUYCQKCX-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.07 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|