C15H12Cl2O2 — CID 54610251
2,4-dichloro-1-[(Z)-2-(2-methoxyphenoxy)ethenyl]benzene (PubChem CID 54610251) has the molecular formula C15H12Cl2O2 and a molecular weight of 295.17 g/mol. Its IUPAC name is 2,4-dichloro-1-[(Z)-2-(2-methoxyphenoxy)ethenyl]benzene.
| Compound Name | 2,4-dichloro-1-[(Z)-2-(2-methoxyphenoxy)ethenyl]benzene |
|---|---|
| PubChem CID | 54610251 |
| Molecular Formula | C15H12Cl2O2 |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 2,4-dichloro-1-[(Z)-2-(2-methoxyphenoxy)ethenyl]benzene |
| SMILES | COc1ccccc1O/C=C\c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl2O2/c1-18-14-4-2-3-5-15(14)19-9-8-11-6-7-12(16)10-13(11)17/h2-10H,1H3/b9-8- |
| InChIKey | ODNCMUGEJGOHGG-HJWRWDBZSA-N |
| XLogP | 5.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|