C8H5Cl3 — CID 609851
2,4-dichloro-1-(2-chloroethenyl)benzene (PubChem CID 609851) has the molecular formula C8H5Cl3 and a molecular weight of 207.49 g/mol. Its IUPAC name is 2,4-dichloro-1-(2-chloroethenyl)benzene.
| Compound Name | 2,4-dichloro-1-(2-chloroethenyl)benzene |
|---|---|
| PubChem CID | 609851 |
| Molecular Formula | C8H5Cl3 |
| Molecular Weight | 207.49 g/mol |
| Exact Mass | 205.95 |
| IUPAC Name | 2,4-dichloro-1-(2-chloroethenyl)benzene |
| SMILES | ClC=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H5Cl3/c9-4-3-6-1-2-7(10)5-8(6)11/h1-5H |
| InChIKey | XWEMGFGRWJFXST-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |