C10H8Cl2O2 — CID 90884165
3-(2,4-dichlorophenyl)prop-2-enyl formate (PubChem CID 90884165) has the molecular formula C10H8Cl2O2 and a molecular weight of 231.08 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)prop-2-enyl formate.
| Compound Name | 3-(2,4-dichlorophenyl)prop-2-enyl formate |
|---|---|
| PubChem CID | 90884165 |
| Molecular Formula | C10H8Cl2O2 |
| Molecular Weight | 231.08 g/mol |
| Exact Mass | 229.99 |
| IUPAC Name | 3-(2,4-dichlorophenyl)prop-2-enyl formate |
| SMILES | O=COCC=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H8Cl2O2/c11-9-4-3-8(10(12)6-9)2-1-5-14-7-13/h1-4,6-7H,5H2 |
| InChIKey | YGNMZUURVVCKJS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.08 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|