C12H14Cl2S — CID 10563343
(E)-6-(2,4-dichlorophenyl)hex-5-ene-1-thiol (PubChem CID 10563343) has the molecular formula C12H14Cl2S and a molecular weight of 261.22 g/mol. Its IUPAC name is (E)-6-(2,4-dichlorophenyl)hex-5-ene-1-thiol.
| Compound Name | (E)-6-(2,4-dichlorophenyl)hex-5-ene-1-thiol |
|---|---|
| PubChem CID | 10563343 |
| Molecular Formula | C12H14Cl2S |
| Molecular Weight | 261.22 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | (E)-6-(2,4-dichlorophenyl)hex-5-ene-1-thiol |
| SMILES | SCCCC/C=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl2S/c13-11-7-6-10(12(14)9-11)5-3-1-2-4-8-15/h3,5-7,9,15H,1-2,4,8H2/b5-3+ |
| InChIKey | ZNGUMUXQNLJDKB-HWKANZROSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.22 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|