C12H14O4 — CID 173173470
[(E)-3-(2,4-dimethoxyphenyl)prop-2-enyl] formate (PubChem CID 173173470) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is [(E)-3-(2,4-dimethoxyphenyl)prop-2-enyl] formate.
| Compound Name | [(E)-3-(2,4-dimethoxyphenyl)prop-2-enyl] formate |
|---|---|
| PubChem CID | 173173470 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | [(E)-3-(2,4-dimethoxyphenyl)prop-2-enyl] formate |
| SMILES | COc1ccc(/C=C/COC=O)c(OC)c1 |
| InChI | InChI=1S/C12H14O4/c1-14-11-6-5-10(12(8-11)15-2)4-3-7-16-9-13/h3-6,8-9H,7H2,1-2H3/b4-3+ |
| InChIKey | JRNKSCBHPNINOL-ONEGZZNKSA-N |
| XLogP | 1.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|