C16H16O3 — CID 56681826
2-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]phenol (PubChem CID 56681826) has the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]phenol.
| Compound Name | 2-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]phenol |
|---|---|
| PubChem CID | 56681826 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]phenol |
| SMILES | COc1ccc(/C=C/c2ccccc2O)c(OC)c1 |
| InChI | InChI=1S/C16H16O3/c1-18-14-10-9-13(16(11-14)19-2)8-7-12-5-3-4-6-15(12)17/h3-11,17H,1-2H3/b8-7+ |
| InChIKey | LFWJEBVAKIRPFZ-BQYQJAHWSA-N |
| XLogP | 3.58 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|