C16H16O4 — CID 131632823
4-[2-(2,4-dimethoxyphenyl)ethenoxy]phenol (PubChem CID 131632823) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is 4-[2-(2,4-dimethoxyphenyl)ethenoxy]phenol.
| Compound Name | 4-[2-(2,4-dimethoxyphenyl)ethenoxy]phenol |
|---|---|
| PubChem CID | 131632823 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 4-[2-(2,4-dimethoxyphenyl)ethenoxy]phenol |
| SMILES | COc1ccc(C=COc2ccc(O)cc2)c(OC)c1 |
| InChI | InChI=1S/C16H16O4/c1-18-15-6-3-12(16(11-15)19-2)9-10-20-14-7-4-13(17)5-8-14/h3-11,17H,1-2H3 |
| InChIKey | FNOZOQILOWGXBB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|