C18H20O5 — CID 72723773
4-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]-2,6-dimethoxyphenol (PubChem CID 72723773) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is 4-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 72723773 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 4-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]-2,6-dimethoxyphenol |
| SMILES | COc1ccc(/C=C/c2cc(OC)c(O)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C18H20O5/c1-20-14-8-7-13(15(11-14)21-2)6-5-12-9-16(22-3)18(19)17(10-12)23-4/h5-11,19H,1-4H3/b6-5+ |
| InChIKey | ZSCTYEIJCKDWEK-AATRIKPKSA-N |
| XLogP | 3.60 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|