C16H15N2O2+ — CID 18996875
4-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]benzenediazonium (PubChem CID 18996875) has the molecular formula C16H15N2O2+ and a molecular weight of 267.31 g/mol. Its IUPAC name is 4-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]benzenediazonium.
| Compound Name | 4-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]benzenediazonium |
|---|---|
| PubChem CID | 18996875 |
| Molecular Formula | C16H15N2O2+ |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 4-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]benzenediazonium |
| SMILES | COc1ccc(/C=C/c2ccc([N+]#N)cc2)c(OC)c1 |
| InChI | InChI=1S/C16H15N2O2/c1-19-15-10-7-13(16(11-15)20-2)6-3-12-4-8-14(18-17)9-5-12/h3-11H,1-2H3/q+1/b6-3+ |
| InChIKey | KQRZGARSJSNOAA-ZZXKWVIFSA-N |
| XLogP | 4.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|