C17H17BrO3 — CID 59502056
1-[(E)-2-(2-bromo-3-methoxyphenyl)ethenyl]-2,4-dimethoxybenzene (PubChem CID 59502056) has the molecular formula C17H17BrO3 and a molecular weight of 349.22 g/mol. Its IUPAC name is 1-[(E)-2-(2-bromo-3-methoxyphenyl)ethenyl]-2,4-dimethoxybenzene.
| Compound Name | 1-[(E)-2-(2-bromo-3-methoxyphenyl)ethenyl]-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 59502056 |
| Molecular Formula | C17H17BrO3 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 1-[(E)-2-(2-bromo-3-methoxyphenyl)ethenyl]-2,4-dimethoxybenzene |
| SMILES | COc1ccc(/C=C/c2cccc(OC)c2Br)c(OC)c1 |
| InChI | InChI=1S/C17H17BrO3/c1-19-14-10-9-12(16(11-14)21-3)7-8-13-5-4-6-15(20-2)17(13)18/h4-11H,1-3H3/b8-7+ |
| InChIKey | LIXXNPNEJWMKAI-BQYQJAHWSA-N |
| XLogP | 4.65 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|