C17H15NO3 — CID 18083405
2-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]-1,3-benzoxazole (PubChem CID 18083405) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is 2-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]-1,3-benzoxazole.
| Compound Name | 2-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 18083405 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 2-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]-1,3-benzoxazole |
| SMILES | COc1ccc(/C=C/c2nc3ccccc3o2)c(OC)c1 |
| InChI | InChI=1S/C17H15NO3/c1-19-13-9-7-12(16(11-13)20-2)8-10-17-18-14-5-3-4-6-15(14)21-17/h3-11H,1-2H3/b10-8+ |
| InChIKey | GPAJEWDVPKOKDR-CSKARUKUSA-N |
| XLogP | 4.02 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |