C16H11Cl3 — CID 10686344
2,4-dichloro-1-[(1E,3Z)-4-chloro-4-phenylbuta-1,3-dienyl]benzene (PubChem CID 10686344) has the molecular formula C16H11Cl3 and a molecular weight of 309.62 g/mol. Its IUPAC name is 2,4-dichloro-1-[(1E,3Z)-4-chloro-4-phenylbuta-1,3-dienyl]benzene.
| Compound Name | 2,4-dichloro-1-[(1E,3Z)-4-chloro-4-phenylbuta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 10686344 |
| Molecular Formula | C16H11Cl3 |
| Molecular Weight | 309.62 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | 2,4-dichloro-1-[(1E,3Z)-4-chloro-4-phenylbuta-1,3-dienyl]benzene |
| SMILES | Cl/C(=C\C=C\c1ccc(Cl)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C16H11Cl3/c17-14-10-9-13(16(19)11-14)7-4-8-15(18)12-5-2-1-3-6-12/h1-11H/b7-4+,15-8- |
| InChIKey | PTFCRBYKGWBBGL-GVEAZFNLSA-N |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.62 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|