C20H16NO6S- — CID 8705743
(E)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-[4-(2-ethoxy-2-oxoethoxy)phenyl]prop-2-enoate (PubChem CID 8705743) has the molecular formula C20H16NO6S- and a molecular weight of 398.42 g/mol. Its IUPAC name is (E)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-[4-(2-ethoxy-2-oxoethoxy)phenyl]prop-2-enoate.
| Compound Name | (E)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-[4-(2-ethoxy-2-oxoethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 8705743 |
| Molecular Formula | C20H16NO6S- |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | (E)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-[4-(2-ethoxy-2-oxoethoxy)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)COc1ccc(/C=C(/Sc2nc3ccccc3o2)C(=O)[O-])cc1 |
| InChI | InChI=1S/C20H17NO6S/c1-2-25-18(22)12-26-14-9-7-13(8-10-14)11-17(19(23)24)28-20-21-15-5-3-4-6-16(15)27-20/h3-11H,2,12H2,1H3,(H,23,24)/p-1/b17-11+ |
| InChIKey | RRRCSDNGYNCZGL-GZTJUZNOSA-M |
| XLogP | 2.65 |
| TPSA | 101.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|