C18H12N2O4S — CID 8705747
(E)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-[4-(cyanomethoxy)phenyl]prop-2-enoic acid (PubChem CID 8705747) has the molecular formula C18H12N2O4S and a molecular weight of 352.37 g/mol. Its IUPAC name is (E)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-[4-(cyanomethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-[4-(cyanomethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 8705747 |
| Molecular Formula | C18H12N2O4S |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | (E)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-[4-(cyanomethoxy)phenyl]prop-2-enoic acid |
| SMILES | N#CCOc1ccc(/C=C(/Sc2nc3ccccc3o2)C(=O)O)cc1 |
| InChI | InChI=1S/C18H12N2O4S/c19-9-10-23-13-7-5-12(6-8-13)11-16(17(21)22)25-18-20-14-3-1-2-4-15(14)24-18/h1-8,11H,10H2,(H,21,22)/b16-11+ |
| InChIKey | NNKQWNYSJZSYLB-LFIBNONCSA-N |
| XLogP | 3.95 |
| TPSA | 96.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|