C16H12ClNO — CID 9038895
2-[(Z)-1-chloro-2-(4-methylphenyl)ethenyl]-1,3-benzoxazole (PubChem CID 9038895) has the molecular formula C16H12ClNO and a molecular weight of 269.73 g/mol. Its IUPAC name is 2-[(Z)-1-chloro-2-(4-methylphenyl)ethenyl]-1,3-benzoxazole.
| Compound Name | 2-[(Z)-1-chloro-2-(4-methylphenyl)ethenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 9038895 |
| Molecular Formula | C16H12ClNO |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 2-[(Z)-1-chloro-2-(4-methylphenyl)ethenyl]-1,3-benzoxazole |
| SMILES | Cc1ccc(/C=C(\Cl)c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C16H12ClNO/c1-11-6-8-12(9-7-11)10-13(17)16-18-14-4-2-3-5-15(14)19-16/h2-10H,1H3/b13-10- |
| InChIKey | NOGQUJQBNQVXBQ-RAXLEYEMSA-N |
| XLogP | 4.87 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |