C13H8ClNOS — CID 9038828
2-[(Z)-1-chloro-2-thiophen-2-ylethenyl]-1,3-benzoxazole (PubChem CID 9038828) has the molecular formula C13H8ClNOS and a molecular weight of 261.73 g/mol. Its IUPAC name is 2-[(Z)-1-chloro-2-thiophen-2-ylethenyl]-1,3-benzoxazole.
| Compound Name | 2-[(Z)-1-chloro-2-thiophen-2-ylethenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 9038828 |
| Molecular Formula | C13H8ClNOS |
| Molecular Weight | 261.73 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | 2-[(Z)-1-chloro-2-thiophen-2-ylethenyl]-1,3-benzoxazole |
| SMILES | Cl/C(=C\c1cccs1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C13H8ClNOS/c14-10(8-9-4-3-7-17-9)13-15-11-5-1-2-6-12(11)16-13/h1-8H/b10-8- |
| InChIKey | NPTSUQQOFMLWLO-NTMALXAHSA-N |
| XLogP | 4.63 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.73 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |