C14H9NO3S — CID 135408470
3-[(Z)-2-hydroxy-2-thiophen-2-ylethenyl]-1,4-benzoxazin-2-one (PubChem CID 135408470) has the molecular formula C14H9NO3S and a molecular weight of 271.30 g/mol. Its IUPAC name is 3-[(Z)-2-hydroxy-2-thiophen-2-ylethenyl]-1,4-benzoxazin-2-one.
| Compound Name | 3-[(Z)-2-hydroxy-2-thiophen-2-ylethenyl]-1,4-benzoxazin-2-one |
|---|---|
| PubChem CID | 135408470 |
| Molecular Formula | C14H9NO3S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 3-[(Z)-2-hydroxy-2-thiophen-2-ylethenyl]-1,4-benzoxazin-2-one |
| SMILES | O=c1oc2ccccc2nc1/C=C(\O)c1cccs1 |
| InChI | InChI=1S/C14H9NO3S/c16-11(13-6-3-7-19-13)8-10-14(17)18-12-5-2-1-4-9(12)15-10/h1-8,16H/b11-8- |
| InChIKey | YABOBRUKPZBOGM-FLIBITNWSA-N |
| XLogP | 3.31 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|