C16H11N3OS — CID 136503517
2-imidazo[1,2-c]quinazolin-5-yl-1-thiophen-2-ylethenol (PubChem CID 136503517) has the molecular formula C16H11N3OS and a molecular weight of 293.35 g/mol. Its IUPAC name is 2-imidazo[1,2-c]quinazolin-5-yl-1-thiophen-2-ylethenol.
| Compound Name | 2-imidazo[1,2-c]quinazolin-5-yl-1-thiophen-2-ylethenol |
|---|---|
| PubChem CID | 136503517 |
| Molecular Formula | C16H11N3OS |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 2-imidazo[1,2-c]quinazolin-5-yl-1-thiophen-2-ylethenol |
| SMILES | OC(=Cc1nc2ccccc2c2nccn12)c1cccs1 |
| InChI | InChI=1S/C16H11N3OS/c20-13(14-6-3-9-21-14)10-15-18-12-5-2-1-4-11(12)16-17-7-8-19(15)16/h1-10,20H |
| InChIKey | QQJONCWFIXIGBI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|