C13H9N5S — CID 177379723
5-thiophen-2-yl-[1,2,4]triazolo[1,5-c]quinazolin-2-amine (PubChem CID 177379723) has the molecular formula C13H9N5S and a molecular weight of 267.32 g/mol. Its IUPAC name is 5-thiophen-2-yl-[1,2,4]triazolo[1,5-c]quinazolin-2-amine.
| Compound Name | 5-thiophen-2-yl-[1,2,4]triazolo[1,5-c]quinazolin-2-amine |
|---|---|
| PubChem CID | 177379723 |
| Molecular Formula | C13H9N5S |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 5-thiophen-2-yl-[1,2,4]triazolo[1,5-c]quinazolin-2-amine |
| SMILES | Nc1nc2c3ccccc3nc(-c3cccs3)n2n1 |
| InChI | InChI=1S/C13H9N5S/c14-13-16-11-8-4-1-2-5-9(8)15-12(18(11)17-13)10-6-3-7-19-10/h1-7H,(H2,14,17) |
| InChIKey | XMSOXVWUIFQNHX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |