C14H13NO3 — CID 139202972
3-[(1Z)-2-hydroxyhexa-1,5-dienyl]-1,4-benzoxazin-2-one (PubChem CID 139202972) has the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. Its IUPAC name is 3-[(1Z)-2-hydroxyhexa-1,5-dienyl]-1,4-benzoxazin-2-one.
| Compound Name | 3-[(1Z)-2-hydroxyhexa-1,5-dienyl]-1,4-benzoxazin-2-one |
|---|---|
| PubChem CID | 139202972 |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 3-[(1Z)-2-hydroxyhexa-1,5-dienyl]-1,4-benzoxazin-2-one |
| SMILES | C=CCC/C(O)=C/c1nc2ccccc2oc1=O |
| InChI | InChI=1S/C14H13NO3/c1-2-3-6-10(16)9-12-14(17)18-13-8-5-4-7-11(13)15-12/h2,4-5,7-9,16H,1,3,6H2/b10-9- |
| InChIKey | CBMRBQBRRIBNQA-KTKRTIGZSA-N |
| XLogP | 3.05 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|