C21H14N2O4S — CID 36668662
[4-(thiophene-2-carbonylamino)phenyl] (E)-3-(1,3-benzoxazol-2-yl)prop-2-enoate (PubChem CID 36668662) has the molecular formula C21H14N2O4S and a molecular weight of 390.42 g/mol. Its IUPAC name is [4-(thiophene-2-carbonylamino)phenyl] (E)-3-(1,3-benzoxazol-2-yl)prop-2-enoate.
| Compound Name | [4-(thiophene-2-carbonylamino)phenyl] (E)-3-(1,3-benzoxazol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 36668662 |
| Molecular Formula | C21H14N2O4S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | [4-(thiophene-2-carbonylamino)phenyl] (E)-3-(1,3-benzoxazol-2-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1nc2ccccc2o1)Oc1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C21H14N2O4S/c24-20(12-11-19-23-16-4-1-2-5-17(16)27-19)26-15-9-7-14(8-10-15)22-21(25)18-6-3-13-28-18/h1-13H,(H,22,25)/b12-11+ |
| InChIKey | ZRAFIEUAGLFXGA-VAWYXSNFSA-N |
| XLogP | 4.76 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|