C20H14N2O3S — CID 1016193
N-[4-(thiophene-2-carbonylamino)phenyl]-1-benzofuran-2-carboxamide (PubChem CID 1016193) has the molecular formula C20H14N2O3S and a molecular weight of 362.41 g/mol. Its IUPAC name is N-[4-(thiophene-2-carbonylamino)phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-(thiophene-2-carbonylamino)phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 1016193 |
| Molecular Formula | C20H14N2O3S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | N-[4-(thiophene-2-carbonylamino)phenyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=O)c2cccs2)cc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C20H14N2O3S/c23-19(17-12-13-4-1-2-5-16(13)25-17)21-14-7-9-15(10-8-14)22-20(24)18-6-3-11-26-18/h1-12H,(H,21,23)(H,22,24) |
| InChIKey | FWCJQKREAWTSDZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |