C22H16N2O3S — CID 86914619
[4-(thiophene-2-carbonylamino)phenyl] 2-methylquinoline-3-carboxylate (PubChem CID 86914619) has the molecular formula C22H16N2O3S and a molecular weight of 388.45 g/mol. Its IUPAC name is [4-(thiophene-2-carbonylamino)phenyl] 2-methylquinoline-3-carboxylate.
| Compound Name | [4-(thiophene-2-carbonylamino)phenyl] 2-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 86914619 |
| Molecular Formula | C22H16N2O3S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | [4-(thiophene-2-carbonylamino)phenyl] 2-methylquinoline-3-carboxylate |
| SMILES | Cc1nc2ccccc2cc1C(=O)Oc1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C22H16N2O3S/c1-14-18(13-15-5-2-3-6-19(15)23-14)22(26)27-17-10-8-16(9-11-17)24-21(25)20-7-4-12-28-20/h2-13H,1H3,(H,24,25) |
| InChIKey | SDHIQODTULNWEW-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|