C21H19N3O6S2 — CID 56514934
[4-(thiophene-2-carbonylamino)phenyl] 5-acetamido-2-(methanesulfonamido)benzoate (PubChem CID 56514934) has the molecular formula C21H19N3O6S2 and a molecular weight of 473.53 g/mol. Its IUPAC name is [4-(thiophene-2-carbonylamino)phenyl] 5-acetamido-2-(methanesulfonamido)benzoate.
| Compound Name | [4-(thiophene-2-carbonylamino)phenyl] 5-acetamido-2-(methanesulfonamido)benzoate |
|---|---|
| PubChem CID | 56514934 |
| Molecular Formula | C21H19N3O6S2 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | [4-(thiophene-2-carbonylamino)phenyl] 5-acetamido-2-(methanesulfonamido)benzoate |
| SMILES | CC(=O)Nc1ccc(NS(C)(=O)=O)c(C(=O)Oc2ccc(NC(=O)c3cccs3)cc2)c1 |
| InChI | InChI=1S/C21H19N3O6S2/c1-13(25)22-15-7-10-18(24-32(2,28)29)17(12-15)21(27)30-16-8-5-14(6-9-16)23-20(26)19-4-3-11-31-19/h3-12,24H,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | CWJWQULWXFVOBP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|