C22H16N2O5S3 — CID 55913986
[4-(thiophene-2-carbonylamino)phenyl] 3-(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 55913986) has the molecular formula C22H16N2O5S3 and a molecular weight of 484.58 g/mol. Its IUPAC name is [4-(thiophene-2-carbonylamino)phenyl] 3-(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | [4-(thiophene-2-carbonylamino)phenyl] 3-(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 55913986 |
| Molecular Formula | C22H16N2O5S3 |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.02 |
| IUPAC Name | [4-(thiophene-2-carbonylamino)phenyl] 3-(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | O=C(Oc1ccc(NC(=O)c2cccs2)cc1)c1cccc(NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C22H16N2O5S3/c25-21(19-6-2-12-30-19)23-16-8-10-18(11-9-16)29-22(26)15-4-1-5-17(14-15)24-32(27,28)20-7-3-13-31-20/h1-14,24H,(H,23,25) |
| InChIKey | LFTKSHNINNGMPL-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|