C24H18N4O5S2 — CID 6906690
[4-[(E)-[[4-(thiophen-2-ylsulfonylamino)benzoyl]hydrazinylidene]methyl]phenyl] pyridine-3-carboxylate (PubChem CID 6906690) has the molecular formula C24H18N4O5S2 and a molecular weight of 506.57 g/mol. Its IUPAC name is [4-[(E)-[[4-(thiophen-2-ylsulfonylamino)benzoyl]hydrazinylidene]methyl]phenyl] pyridine-3-carboxylate.
| Compound Name | [4-[(E)-[[4-(thiophen-2-ylsulfonylamino)benzoyl]hydrazinylidene]methyl]phenyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 6906690 |
| Molecular Formula | C24H18N4O5S2 |
| Molecular Weight | 506.57 g/mol |
| Exact Mass | 506.07 |
| IUPAC Name | [4-[(E)-[[4-(thiophen-2-ylsulfonylamino)benzoyl]hydrazinylidene]methyl]phenyl] pyridine-3-carboxylate |
| SMILES | O=C(N/N=C/c1ccc(OC(=O)c2cccnc2)cc1)c1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C24H18N4O5S2/c29-23(18-7-9-20(10-8-18)28-35(31,32)22-4-2-14-34-22)27-26-15-17-5-11-21(12-6-17)33-24(30)19-3-1-13-25-16-19/h1-16,28H,(H,27,29)/b26-15+ |
| InChIKey | IISMOROUSKLDRA-CVKSISIWSA-N |
| XLogP | 3.93 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|